C15H21N7S — CID 90053454
5-(5-aminopent-1-ynyl)-2-N-(5-methyl-1,3,4-thiadiazol-2-yl)-4-N-propylpyrimidine-2,4-diamine (PubChem CID 90053454) has the molecular formula C15H21N7S and a molecular weight of 331.45 g/mol. Its IUPAC name is 5-(5-aminopent-1-ynyl)-2-N-(5-methyl-1,3,4-thiadiazol-2-yl)-4-N-propylpyrimidine-2,4-diamine.
| Compound Name | 5-(5-aminopent-1-ynyl)-2-N-(5-methyl-1,3,4-thiadiazol-2-yl)-4-N-propylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 90053454 |
| Molecular Formula | C15H21N7S |
| Molecular Weight | 331.45 g/mol |
| Exact Mass | 331.16 |
| IUPAC Name | 5-(5-aminopent-1-ynyl)-2-N-(5-methyl-1,3,4-thiadiazol-2-yl)-4-N-propylpyrimidine-2,4-diamine |
| SMILES | CCCNc1nc(Nc2nnc(C)s2)ncc1C#CCCCN |
| InChI | InChI=1S/C15H21N7S/c1-3-9-17-13-12(7-5-4-6-8-16)10-18-14(19-13)20-15-22-21-11(2)23-15/h10H,3-4,6,8-9,16H2,1-2H3,(H2,17,18,19,20,22) |
| InChIKey | WZRQMTOQSJHZOJ-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 101.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.45 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|