C35H43BFN3O4 — CID 90053605
tert-butyl 2-[5-[3-fluoro-4-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-tricyclo[6.2.1.02,7]undeca-2,4,6-trienyl]phenyl]-1H-imidazol-2-yl]pyrrolidine-1-carboxylate (PubChem CID 90053605) has the molecular formula C35H43BFN3O4 and a molecular weight of 599.56 g/mol. Its IUPAC name is tert-butyl 2-[5-[3-fluoro-4-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-tricyclo[6.2.1.02,7]undeca-2,4,6-trienyl]phenyl]-1H-imidazol-2-yl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 2-[5-[3-fluoro-4-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-tricyclo[6.2.1.02,7]undeca-2,4,6-trienyl]phenyl]-1H-imidazol-2-yl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 90053605 |
| Molecular Formula | C35H43BFN3O4 |
| Molecular Weight | 599.56 g/mol |
| Exact Mass | 599.33 |
| IUPAC Name | tert-butyl 2-[5-[3-fluoro-4-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-tricyclo[6.2.1.02,7]undeca-2,4,6-trienyl]phenyl]-1H-imidazol-2-yl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC1c1ncc(-c2ccc(-c3ccc(B4OC(C)(C)C(C)(C)O4)c4c3C3CCC4C3)c(F)c2)[nH]1 |
| InChI | InChI=1S/C35H43BFN3O4/c1-33(2,3)42-32(41)40-16-8-9-28(40)31-38-19-27(39-31)20-12-13-23(26(37)18-20)24-14-15-25(30-22-11-10-21(17-22)29(24)30)36-43-34(4,5)35(6,7)44-36/h12-15,18-19,21-22,28H,8-11,16-17H2,1-7H3,(H,38,39) |
| InChIKey | GSTNFBHETINXIA-UHFFFAOYSA-N |
| XLogP | 7.62 |
| TPSA | 76.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.56 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|