C22H14ClN3O3S — CID 90054272
4-chloro-2-(4-formylphenyl)-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridine-5-carbonitrile (PubChem CID 90054272) has the molecular formula C22H14ClN3O3S and a molecular weight of 435.89 g/mol. Its IUPAC name is 4-chloro-2-(4-formylphenyl)-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridine-5-carbonitrile.
| Compound Name | 4-chloro-2-(4-formylphenyl)-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridine-5-carbonitrile |
|---|---|
| PubChem CID | 90054272 |
| Molecular Formula | C22H14ClN3O3S |
| Molecular Weight | 435.89 g/mol |
| Exact Mass | 435.04 |
| IUPAC Name | 4-chloro-2-(4-formylphenyl)-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridine-5-carbonitrile |
| SMILES | Cc1ccc(S(=O)(=O)n2c(-c3ccc(C=O)cc3)cc3c(Cl)c(C#N)cnc32)cc1 |
| InChI | InChI=1S/C22H14ClN3O3S/c1-14-2-8-18(9-3-14)30(28,29)26-20(16-6-4-15(13-27)5-7-16)10-19-21(23)17(11-24)12-25-22(19)26/h2-10,12-13H,1H3 |
| InChIKey | UPSAQUSDGDKVQC-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 92.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.89 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|