About 2,7-bis(3,7-dimethyloctan-3-yl)fluoren-9-one
2,7-bis(3,7-dimethyloctan-3-yl)fluoren-9-one (PubChem CID 90054682) has the molecular formula C33H48O
and a molecular weight of 460.75 g/mol. Its IUPAC name is 2,7-bis(3,7-dimethyloctan-3-yl)fluoren-9-one.
Molecular Properties
| Compound Name | 2,7-bis(3,7-dimethyloctan-3-yl)fluoren-9-one |
| PubChem CID | 90054682 |
| Molecular Formula | C33H48O |
| Molecular Weight | 460.75 g/mol |
| Exact Mass | 460.37 |
| IUPAC Name | 2,7-bis(3,7-dimethyloctan-3-yl)fluoren-9-one |
| SMILES | CCC(C)(CCCC(C)C)c1ccc2c(c1)C(=O)c1cc(C(C)(CC)CCCC(C)C)ccc1-2 |
| InChI | InChI=1S/C33H48O/c1-9-32(7,19-11-13-23(3)4)25-15-17-27-28-18-16-26(22-30(28)31(34)29(27)21-25)33(8,10-2)20-12-14-24(5)6/h15-18,21-24H,9-14,19-20H2,1-8H3 |
| InChIKey | KRQGAPABEZKUIM-UHFFFAOYSA-N |
| XLogP | 9.89 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 460.75 |
| LogP ≤ 5 | 9.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,7-bis(3,7-dimethyloctan-3-yl)fluoren-9-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,7-bis(3,7-dimethyloctan-3-yl)fluoren-9-one?
The IUPAC name of 2,7-bis(3,7-dimethyloctan-3-yl)fluoren-9-one (CID 90054682) is 2,7-bis(3,7-dimethyloctan-3-yl)fluoren-9-one.
What is the SMILES notation for 2,7-bis(3,7-dimethyloctan-3-yl)fluoren-9-one?
The canonical SMILES for 2,7-bis(3,7-dimethyloctan-3-yl)fluoren-9-one is CCC(C)(CCCC(C)C)c1ccc2c(c1)C(=O)c1cc(C(C)(CC)CCCC(C)C)ccc1-2.
What is the InChIKey of 2,7-bis(3,7-dimethyloctan-3-yl)fluoren-9-one?
The InChIKey is KRQGAPABEZKUIM-UHFFFAOYSA-N. The full InChI is InChI=1S/C33H48O/c1-9-32(7,19-11-13-23(3)4)25-15-17-27-28-18-16-26(22-30(28)31(34)29(27)21-25)33(8,10-2)20-12-14-24(5)6/h15-18,21-24H,9-14,19-20H2,1-8H3.
What are the key properties of 2,7-bis(3,7-dimethyloctan-3-yl)fluoren-9-one?
2,7-bis(3,7-dimethyloctan-3-yl)fluoren-9-one has a molecular weight of 460.75 g/mol, XLogP of 9.89, 12 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,7-bis(3,7-dimethyloctan-3-yl)fluoren-9-one is sourced from PubChem (CID 90054682), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).