About 1-[2-(4-methylpenta-1,3-dien-2-yloxy)ethyl]pyrrolidine
1-[2-(4-methylpenta-1,3-dien-2-yloxy)ethyl]pyrrolidine (PubChem CID 90054690) has the molecular formula C12H21NO
and a molecular weight of 195.31 g/mol. Its IUPAC name is 1-[2-(4-methylpenta-1,3-dien-2-yloxy)ethyl]pyrrolidine.
Molecular Properties
| Compound Name | 1-[2-(4-methylpenta-1,3-dien-2-yloxy)ethyl]pyrrolidine |
| PubChem CID | 90054690 |
| Molecular Formula | C12H21NO |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.16 |
| IUPAC Name | 1-[2-(4-methylpenta-1,3-dien-2-yloxy)ethyl]pyrrolidine |
| SMILES | C=C(C=C(C)C)OCCN1CCCC1 |
| InChI | InChI=1S/C12H21NO/c1-11(2)10-12(3)14-9-8-13-6-4-5-7-13/h10H,3-9H2,1-2H3 |
| InChIKey | ZZDRHOHSBOYJRO-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1-[2-(4-methylpenta-1,3-dien-2-yloxy)ethyl]pyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(4-methylpenta-1,3-dien-2-yloxy)ethyl]pyrrolidine?
The IUPAC name of 1-[2-(4-methylpenta-1,3-dien-2-yloxy)ethyl]pyrrolidine (CID 90054690) is 1-[2-(4-methylpenta-1,3-dien-2-yloxy)ethyl]pyrrolidine.
What is the SMILES notation for 1-[2-(4-methylpenta-1,3-dien-2-yloxy)ethyl]pyrrolidine?
The canonical SMILES for 1-[2-(4-methylpenta-1,3-dien-2-yloxy)ethyl]pyrrolidine is C=C(C=C(C)C)OCCN1CCCC1.
What is the InChIKey of 1-[2-(4-methylpenta-1,3-dien-2-yloxy)ethyl]pyrrolidine?
The InChIKey is ZZDRHOHSBOYJRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21NO/c1-11(2)10-12(3)14-9-8-13-6-4-5-7-13/h10H,3-9H2,1-2H3.
What are the key properties of 1-[2-(4-methylpenta-1,3-dien-2-yloxy)ethyl]pyrrolidine?
1-[2-(4-methylpenta-1,3-dien-2-yloxy)ethyl]pyrrolidine has a molecular weight of 195.31 g/mol, XLogP of 2.58, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(4-methylpenta-1,3-dien-2-yloxy)ethyl]pyrrolidine is sourced from PubChem (CID 90054690), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).