About 2-(4-aminopyrido[3,2-d]pyrimidin-6-yl)oxybenzonitrile
2-(4-aminopyrido[3,2-d]pyrimidin-6-yl)oxybenzonitrile (PubChem CID 90054807) has the molecular formula C14H9N5O
and a molecular weight of 263.26 g/mol. Its IUPAC name is 2-(4-aminopyrido[3,2-d]pyrimidin-6-yl)oxybenzonitrile.
Molecular Properties
| Compound Name | 2-(4-aminopyrido[3,2-d]pyrimidin-6-yl)oxybenzonitrile |
| PubChem CID | 90054807 |
| Molecular Formula | C14H9N5O |
| Molecular Weight | 263.26 g/mol |
| Exact Mass | 263.08 |
| IUPAC Name | 2-(4-aminopyrido[3,2-d]pyrimidin-6-yl)oxybenzonitrile |
| SMILES | N#Cc1ccccc1Oc1ccc2ncnc(N)c2n1 |
| InChI | InChI=1S/C14H9N5O/c15-7-9-3-1-2-4-11(9)20-12-6-5-10-13(19-12)14(16)18-8-17-10/h1-6,8H,(H2,16,17,18) |
| InChIKey | GCMNMLMNCPMSCH-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 97.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.26 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-(4-aminopyrido[3,2-d]pyrimidin-6-yl)oxybenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-aminopyrido[3,2-d]pyrimidin-6-yl)oxybenzonitrile?
The IUPAC name of 2-(4-aminopyrido[3,2-d]pyrimidin-6-yl)oxybenzonitrile (CID 90054807) is 2-(4-aminopyrido[3,2-d]pyrimidin-6-yl)oxybenzonitrile.
What is the SMILES notation for 2-(4-aminopyrido[3,2-d]pyrimidin-6-yl)oxybenzonitrile?
The canonical SMILES for 2-(4-aminopyrido[3,2-d]pyrimidin-6-yl)oxybenzonitrile is N#Cc1ccccc1Oc1ccc2ncnc(N)c2n1.
What is the InChIKey of 2-(4-aminopyrido[3,2-d]pyrimidin-6-yl)oxybenzonitrile?
The InChIKey is GCMNMLMNCPMSCH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H9N5O/c15-7-9-3-1-2-4-11(9)20-12-6-5-10-13(19-12)14(16)18-8-17-10/h1-6,8H,(H2,16,17,18).
What are the key properties of 2-(4-aminopyrido[3,2-d]pyrimidin-6-yl)oxybenzonitrile?
2-(4-aminopyrido[3,2-d]pyrimidin-6-yl)oxybenzonitrile has a molecular weight of 263.26 g/mol, XLogP of 2.27, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-aminopyrido[3,2-d]pyrimidin-6-yl)oxybenzonitrile is sourced from PubChem (CID 90054807), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).