C45H33N5 — CID 90055724
5-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-7-phenyl-8,9,10,11-tetrahydroindolo[2,3-b]carbazole (PubChem CID 90055724) has the molecular formula C45H33N5 and a molecular weight of 643.79 g/mol. Its IUPAC name is 5-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-7-phenyl-8,9,10,11-tetrahydroindolo[2,3-b]carbazole.
| Compound Name | 5-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-7-phenyl-8,9,10,11-tetrahydroindolo[2,3-b]carbazole |
|---|---|
| PubChem CID | 90055724 |
| Molecular Formula | C45H33N5 |
| Molecular Weight | 643.79 g/mol |
| Exact Mass | 643.27 |
| IUPAC Name | 5-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-7-phenyl-8,9,10,11-tetrahydroindolo[2,3-b]carbazole |
| SMILES | c1ccc(-c2nc(-c3ccccc3)nc(-c3cccc(-n4c5ccccc5c5cc6c7c(n(-c8ccccc8)c6cc54)CCCC7)c3)n2)cc1 |
| InChI | InChI=1S/C45H33N5/c1-4-15-30(16-5-1)43-46-44(31-17-6-2-7-18-31)48-45(47-43)32-19-14-22-34(27-32)50-40-26-13-11-24-36(40)38-28-37-35-23-10-12-25-39(35)49(41(37)29-42(38)50)33-20-8-3-9-21-33/h1-9,11,13-22,24,26-29H,10,12,23,25H2 |
| InChIKey | PYECNZUKCLVQTH-UHFFFAOYSA-N |
| XLogP | 10.79 |
| TPSA | 48.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.79 |
| LogP ≤ 5 | 10.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |