C19H23NO2 — CID 90055846
1-[4-[(1E,4Z,6Z)-3-methylideneocta-1,4,6-trienyl]phenyl]pyrrolidine-3,4-diol (PubChem CID 90055846) has the molecular formula C19H23NO2 and a molecular weight of 297.40 g/mol. Its IUPAC name is 1-[4-[(1E,4Z,6Z)-3-methylideneocta-1,4,6-trienyl]phenyl]pyrrolidine-3,4-diol.
| Compound Name | 1-[4-[(1E,4Z,6Z)-3-methylideneocta-1,4,6-trienyl]phenyl]pyrrolidine-3,4-diol |
|---|---|
| PubChem CID | 90055846 |
| Molecular Formula | C19H23NO2 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | 1-[4-[(1E,4Z,6Z)-3-methylideneocta-1,4,6-trienyl]phenyl]pyrrolidine-3,4-diol |
| SMILES | C=C(/C=C\C=C/C)/C=C/c1ccc(N2CC(O)C(O)C2)cc1 |
| InChI | InChI=1S/C19H23NO2/c1-3-4-5-6-15(2)7-8-16-9-11-17(12-10-16)20-13-18(21)19(22)14-20/h3-12,18-19,21-22H,2,13-14H2,1H3/b4-3-,6-5-,8-7+ |
| InChIKey | NECAAVVUXNIGSI-YUHUOFHPSA-N |
| XLogP | 2.93 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|