About US9242973, RP11a
US9242973, RP11a (PubChem CID 90056187) has the molecular formula C16H19BrN2O3
and a molecular weight of 367.24 g/mol.
Molecular Properties
| Compound Name | US9242973, RP11a |
| PubChem CID | 90056187 |
| Molecular Formula | C16H19BrN2O3 |
| Molecular Weight | 367.24 g/mol |
| Exact Mass | 366.06 |
| IUPAC Name | — |
| SMILES | CCCC1Oc2ccc(Br)cc2C2(COC(N)=N2)C12COC2 |
| InChI | InChI=1S/C16H19BrN2O3/c1-2-3-13-15(7-20-8-15)16(9-21-14(18)19-16)11-6-10(17)4-5-12(11)22-13/h4-6,13H,2-3,7-9H2,1H3,(H2,18,19) |
| InChIKey | PCABGJMPWSJFMR-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 66.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.24 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze US9242973, RP11a with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of US9242973, RP11a?
The IUPAC name of US9242973, RP11a (CID 90056187) is not available.
What is the SMILES notation for US9242973, RP11a?
The canonical SMILES for US9242973, RP11a is CCCC1Oc2ccc(Br)cc2C2(COC(N)=N2)C12COC2.
What is the InChIKey of US9242973, RP11a?
The InChIKey is PCABGJMPWSJFMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19BrN2O3/c1-2-3-13-15(7-20-8-15)16(9-21-14(18)19-16)11-6-10(17)4-5-12(11)22-13/h4-6,13H,2-3,7-9H2,1H3,(H2,18,19).
What are the key properties of US9242973, RP11a?
US9242973, RP11a has a molecular weight of 367.24 g/mol, XLogP of 2.57, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for US9242973, RP11a is sourced from PubChem (CID 90056187), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).