C19H19N3O3 — CID 90056199
CID 90056199 (PubChem CID 90056199) has the molecular formula C19H19N3O3 and a molecular weight of 337.38 g/mol.
| Compound Name | CID 90056199 |
|---|---|
| PubChem CID | 90056199 |
| Molecular Formula | C19H19N3O3 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.14 |
| IUPAC Name | — |
| SMILES | COc1cncc(-c2ccc3c(c2)C2(COC(N)=N2)C2(CC2)CO3)c1 |
| InChI | InChI=1S/C19H19N3O3/c1-23-14-6-13(8-21-9-14)12-2-3-16-15(7-12)19(11-25-17(20)22-19)18(4-5-18)10-24-16/h2-3,6-9H,4-5,10-11H2,1H3,(H2,20,22) |
| InChIKey | ZOGSWBUPTFGEHZ-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 78.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |