About CID 90056333
CID 90056333 (PubChem CID 90056333) has the molecular formula C21H19F3N2O3
and a molecular weight of 404.39 g/mol.
Molecular Properties
| Compound Name | CID 90056333 |
| PubChem CID | 90056333 |
| Molecular Formula | C21H19F3N2O3 |
| Molecular Weight | 404.39 g/mol |
| Exact Mass | 404.13 |
| IUPAC Name | — |
| SMILES | CC1(C)Oc2ccc(-c3c(F)ccc(F)c3F)cc2C2(COC(N)=N2)C12COC2 |
| InChI | InChI=1S/C21H19F3N2O3/c1-19(2)20(8-27-9-20)21(10-28-18(25)26-21)12-7-11(3-6-15(12)29-19)16-13(22)4-5-14(23)17(16)24/h3-7H,8-10H2,1-2H3,(H2,25,26) |
| InChIKey | MDDVTIQXTKOMRK-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 66.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 404.39 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze CID 90056333 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 90056333?
The IUPAC name of CID 90056333 (CID 90056333) is not available.
What is the SMILES notation for CID 90056333?
The canonical SMILES for CID 90056333 is CC1(C)Oc2ccc(-c3c(F)ccc(F)c3F)cc2C2(COC(N)=N2)C12COC2.
What is the InChIKey of CID 90056333?
The InChIKey is MDDVTIQXTKOMRK-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H19F3N2O3/c1-19(2)20(8-27-9-20)21(10-28-18(25)26-21)12-7-11(3-6-15(12)29-19)16-13(22)4-5-14(23)17(16)24/h3-7H,8-10H2,1-2H3,(H2,25,26).
What are the key properties of CID 90056333?
CID 90056333 has a molecular weight of 404.39 g/mol, XLogP of 3.50, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 90056333 is sourced from PubChem (CID 90056333), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).