C23H21F2N7 — CID 90056520
[7-(6,7-difluoroquinoxalin-2-yl)-1-methyl-2-(2-methylphenyl)-5,6,8,8a-tetrahydro-1H-imidazo[1,5-a]pyrazin-3-ylidene]cyanamide (PubChem CID 90056520) has the molecular formula C23H21F2N7 and a molecular weight of 433.47 g/mol. Its IUPAC name is [7-(6,7-difluoroquinoxalin-2-yl)-1-methyl-2-(2-methylphenyl)-5,6,8,8a-tetrahydro-1H-imidazo[1,5-a]pyrazin-3-ylidene]cyanamide.
| Compound Name | [7-(6,7-difluoroquinoxalin-2-yl)-1-methyl-2-(2-methylphenyl)-5,6,8,8a-tetrahydro-1H-imidazo[1,5-a]pyrazin-3-ylidene]cyanamide |
|---|---|
| PubChem CID | 90056520 |
| Molecular Formula | C23H21F2N7 |
| Molecular Weight | 433.47 g/mol |
| Exact Mass | 433.18 |
| IUPAC Name | [7-(6,7-difluoroquinoxalin-2-yl)-1-methyl-2-(2-methylphenyl)-5,6,8,8a-tetrahydro-1H-imidazo[1,5-a]pyrazin-3-ylidene]cyanamide |
| SMILES | Cc1ccccc1N1/C(=N/C#N)N2CCN(c3cnc4cc(F)c(F)cc4n3)CC2C1C |
| InChI | InChI=1S/C23H21F2N7/c1-14-5-3-4-6-20(14)32-15(2)21-12-30(7-8-31(21)23(32)28-13-26)22-11-27-18-9-16(24)17(25)10-19(18)29-22/h3-6,9-11,15,21H,7-8,12H2,1-2H3/b28-23+ |
| InChIKey | GJWGPYOKEAWQKK-WEMUOSSPSA-N |
| XLogP | 3.45 |
| TPSA | 71.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.47 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|