C18H17N6O6S3- — CID 90056689
2-[[5-(1-methyl-2-oxo-4-pyridinyl)-1,3-benzothiazol-2-yl]-methylsulfonylmethyl]-5-[(2-sulfinatohydrazinyl)methyl]-1,3,4-oxadiazole (PubChem CID 90056689) has the molecular formula C18H17N6O6S3- and a molecular weight of 509.57 g/mol. Its IUPAC name is 2-[[5-(1-methyl-2-oxo-4-pyridinyl)-1,3-benzothiazol-2-yl]-methylsulfonylmethyl]-5-[(2-sulfinatohydrazinyl)methyl]-1,3,4-oxadiazole.
| Compound Name | 2-[[5-(1-methyl-2-oxo-4-pyridinyl)-1,3-benzothiazol-2-yl]-methylsulfonylmethyl]-5-[(2-sulfinatohydrazinyl)methyl]-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 90056689 |
| Molecular Formula | C18H17N6O6S3- |
| Molecular Weight | 509.57 g/mol |
| Exact Mass | 509.04 |
| IUPAC Name | 2-[[5-(1-methyl-2-oxo-4-pyridinyl)-1,3-benzothiazol-2-yl]-methylsulfonylmethyl]-5-[(2-sulfinatohydrazinyl)methyl]-1,3,4-oxadiazole |
| SMILES | Cn1ccc(-c2ccc3sc(C(c4nnc(CNNS(=O)[O-])o4)S(C)(=O)=O)nc3c2)cc1=O |
| InChI | InChI=1S/C18H18N6O6S3/c1-24-6-5-11(8-15(24)25)10-3-4-13-12(7-10)20-18(31-13)16(33(2,28)29)17-22-21-14(30-17)9-19-23-32(26)27/h3-8,16,19,23H,9H2,1-2H3,(H,26,27)/p-1 |
| InChIKey | CAFOPEIIVOXQHZ-UHFFFAOYSA-M |
| XLogP | 0.57 |
| TPSA | 172.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.57 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|