C18H12F8N6O4S2 — CID 90056789
4-azido-6-[2-[2-(3-azido-6-carboxy-1,2,4,5-tetrafluorocyclohexa-2,4-dien-1-yl)ethyldisulfanyl]ethyl]-2,3,5,6-tetrafluorocyclohexa-2,4-diene-1-carboxylic acid (PubChem CID 90056789) has the molecular formula C18H12F8N6O4S2 and a molecular weight of 592.45 g/mol. Its IUPAC name is 4-azido-6-[2-[2-(3-azido-6-carboxy-1,2,4,5-tetrafluorocyclohexa-2,4-dien-1-yl)ethyldisulfanyl]ethyl]-2,3,5,6-tetrafluorocyclohexa-2,4-diene-1-carboxylic acid.
| Compound Name | 4-azido-6-[2-[2-(3-azido-6-carboxy-1,2,4,5-tetrafluorocyclohexa-2,4-dien-1-yl)ethyldisulfanyl]ethyl]-2,3,5,6-tetrafluorocyclohexa-2,4-diene-1-carboxylic acid |
|---|---|
| PubChem CID | 90056789 |
| Molecular Formula | C18H12F8N6O4S2 |
| Molecular Weight | 592.45 g/mol |
| Exact Mass | 592.02 |
| IUPAC Name | 4-azido-6-[2-[2-(3-azido-6-carboxy-1,2,4,5-tetrafluorocyclohexa-2,4-dien-1-yl)ethyldisulfanyl]ethyl]-2,3,5,6-tetrafluorocyclohexa-2,4-diene-1-carboxylic acid |
| SMILES | [N-]=[N+]=NC1=C(F)C(F)(CCSSCCC2(F)C(F)=C(N=[N+]=[N-])C(F)=C(F)C2C(=O)O)C(C(=O)O)C(F)=C1F |
| InChI | InChI=1S/C18H12F8N6O4S2/c19-7-5(15(33)34)17(25,13(23)11(9(7)21)29-31-27)1-3-37-38-4-2-18(26)6(16(35)36)8(20)10(22)12(14(18)24)30-32-28/h5-6H,1-4H2,(H,33,34)(H,35,36) |
| InChIKey | DJEJLJDPSLJVIW-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 172.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.45 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|