C21H30F3N2O5S+ — CID 90056973
[2-[1,1-dimethyl-3-[(4-pentylphenyl)sulfonylamino]pyrrolidin-1-ium-3-yl]acetyl] 2,2,2-trifluoroacetate (PubChem CID 90056973) has the molecular formula C21H30F3N2O5S+ and a molecular weight of 479.54 g/mol. Its IUPAC name is [2-[1,1-dimethyl-3-[(4-pentylphenyl)sulfonylamino]pyrrolidin-1-ium-3-yl]acetyl] 2,2,2-trifluoroacetate.
| Compound Name | [2-[1,1-dimethyl-3-[(4-pentylphenyl)sulfonylamino]pyrrolidin-1-ium-3-yl]acetyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 90056973 |
| Molecular Formula | C21H30F3N2O5S+ |
| Molecular Weight | 479.54 g/mol |
| Exact Mass | 479.18 |
| IUPAC Name | [2-[1,1-dimethyl-3-[(4-pentylphenyl)sulfonylamino]pyrrolidin-1-ium-3-yl]acetyl] 2,2,2-trifluoroacetate |
| SMILES | CCCCCc1ccc(S(=O)(=O)NC2(CC(=O)OC(=O)C(F)(F)F)CC[N+](C)(C)C2)cc1 |
| InChI | InChI=1S/C21H30F3N2O5S/c1-4-5-6-7-16-8-10-17(11-9-16)32(29,30)25-20(12-13-26(2,3)15-20)14-18(27)31-19(28)21(22,23)24/h8-11,25H,4-7,12-15H2,1-3H3/q+1 |
| InChIKey | PQCHHJOUSGJZBT-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.54 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|