C12H8F6O — CID 90057089
1,1,1,3,3,3-hexafluoro-2-(1H-inden-4-yl)propan-2-ol (PubChem CID 90057089) has the molecular formula C12H8F6O and a molecular weight of 282.18 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoro-2-(1H-inden-4-yl)propan-2-ol.
| Compound Name | 1,1,1,3,3,3-hexafluoro-2-(1H-inden-4-yl)propan-2-ol |
|---|---|
| PubChem CID | 90057089 |
| Molecular Formula | C12H8F6O |
| Molecular Weight | 282.18 g/mol |
| Exact Mass | 282.05 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoro-2-(1H-inden-4-yl)propan-2-ol |
| SMILES | OC(c1cccc2c1C=CC2)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C12H8F6O/c13-11(14,15)10(19,12(16,17)18)9-6-2-4-7-3-1-5-8(7)9/h1-2,4-6,19H,3H2 |
| InChIKey | WFWUBZAHVPXZCB-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.18 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |