C77H66N2S4 — CID 90057821
2-N',2-N',7-N',7-N'-tetrakis[4-(3,4,5-trimethylthiophen-2-yl)phenyl]-9,9'-spirobi[fluorene]-2',7'-diamine (PubChem CID 90057821) has the molecular formula C77H66N2S4 and a molecular weight of 1147.66 g/mol. Its IUPAC name is 2-N',2-N',7-N',7-N'-tetrakis[4-(3,4,5-trimethylthiophen-2-yl)phenyl]-9,9'-spirobi[fluorene]-2',7'-diamine.
| Compound Name | 2-N',2-N',7-N',7-N'-tetrakis[4-(3,4,5-trimethylthiophen-2-yl)phenyl]-9,9'-spirobi[fluorene]-2',7'-diamine |
|---|---|
| PubChem CID | 90057821 |
| Molecular Formula | C77H66N2S4 |
| Molecular Weight | 1147.66 g/mol |
| Exact Mass | 1146.41 |
| IUPAC Name | 2-N',2-N',7-N',7-N'-tetrakis[4-(3,4,5-trimethylthiophen-2-yl)phenyl]-9,9'-spirobi[fluorene]-2',7'-diamine |
| SMILES | Cc1sc(-c2ccc(N(c3ccc(-c4sc(C)c(C)c4C)cc3)c3ccc4c(c3)C3(c5ccccc5-c5ccccc53)c3cc(N(c5ccc(-c6sc(C)c(C)c6C)cc5)c5ccc(-c6sc(C)c(C)c6C)cc5)ccc3-4)cc2)c(C)c1C |
| InChI | InChI=1S/C77H66N2S4/c1-43-47(5)73(80-51(43)9)55-21-29-59(30-22-55)78(60-31-23-56(24-32-60)74-48(6)44(2)52(10)81-74)63-37-39-67-68-40-38-64(42-72(68)77(71(67)41-63)69-19-15-13-17-65(69)66-18-14-16-20-70(66)77)79(61-33-25-57(26-34-61)75-49(7)45(3)53(11)82-75)62-35-27-58(28-36-62)76-50(8)46(4)54(12)83-76/h13-42H,1-12H3 |
| InChIKey | SPFCHLASVWGJQC-UHFFFAOYSA-N |
| XLogP | 23.58 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 83 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1147.66 |
| LogP ≤ 5 | 23.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |