C10H17NO2S — CID 90058003
(3E,5Z)-N,2-dimethylocta-3,5,7-triene-4-sulfonamide (PubChem CID 90058003) has the molecular formula C10H17NO2S and a molecular weight of 215.32 g/mol. Its IUPAC name is (3E,5Z)-N,2-dimethylocta-3,5,7-triene-4-sulfonamide.
| Compound Name | (3E,5Z)-N,2-dimethylocta-3,5,7-triene-4-sulfonamide |
|---|---|
| PubChem CID | 90058003 |
| Molecular Formula | C10H17NO2S |
| Molecular Weight | 215.32 g/mol |
| Exact Mass | 215.10 |
| IUPAC Name | (3E,5Z)-N,2-dimethylocta-3,5,7-triene-4-sulfonamide |
| SMILES | C=C/C=C\C(=C/C(C)C)S(=O)(=O)NC |
| InChI | InChI=1S/C10H17NO2S/c1-5-6-7-10(8-9(2)3)14(12,13)11-4/h5-9,11H,1H2,2-4H3/b7-6-,10-8+ |
| InChIKey | CKIGRRMVCKOHLD-VAAURPRASA-N |
| XLogP | 1.82 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.32 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|