C14H23NO5 — CID 90058118
(2S)-3,3-dimethyl-2-[[(1R,2R)-2-(4-oxobutyl)cyclopropyl]oxycarbonylamino]butanoic acid (PubChem CID 90058118) has the molecular formula C14H23NO5 and a molecular weight of 285.34 g/mol. Its IUPAC name is (2S)-3,3-dimethyl-2-[[(1R,2R)-2-(4-oxobutyl)cyclopropyl]oxycarbonylamino]butanoic acid.
| Compound Name | (2S)-3,3-dimethyl-2-[[(1R,2R)-2-(4-oxobutyl)cyclopropyl]oxycarbonylamino]butanoic acid |
|---|---|
| PubChem CID | 90058118 |
| Molecular Formula | C14H23NO5 |
| Molecular Weight | 285.34 g/mol |
| Exact Mass | 285.16 |
| IUPAC Name | (2S)-3,3-dimethyl-2-[[(1R,2R)-2-(4-oxobutyl)cyclopropyl]oxycarbonylamino]butanoic acid |
| SMILES | CC(C)(C)[C@H](NC(=O)O[C@@H]1C[C@H]1CCCC=O)C(=O)O |
| InChI | InChI=1S/C14H23NO5/c1-14(2,3)11(12(17)18)15-13(19)20-10-8-9(10)6-4-5-7-16/h7,9-11H,4-6,8H2,1-3H3,(H,15,19)(H,17,18)/t9-,10-,11-/m1/s1 |
| InChIKey | TWGBYMMVOJUSAR-GMTAPVOTSA-N |
| XLogP | 1.97 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.34 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|