About 7-methoxy-3-pentyl-1,2-dihydroquinolin-2-ol
7-methoxy-3-pentyl-1,2-dihydroquinolin-2-ol (PubChem CID 90058164) has the molecular formula C15H21NO2
and a molecular weight of 247.34 g/mol. Its IUPAC name is 7-methoxy-3-pentyl-1,2-dihydroquinolin-2-ol.
Molecular Properties
| Compound Name | 7-methoxy-3-pentyl-1,2-dihydroquinolin-2-ol |
| PubChem CID | 90058164 |
| Molecular Formula | C15H21NO2 |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.16 |
| IUPAC Name | 7-methoxy-3-pentyl-1,2-dihydroquinolin-2-ol |
| SMILES | CCCCCC1=Cc2ccc(OC)cc2NC1O |
| InChI | InChI=1S/C15H21NO2/c1-3-4-5-6-12-9-11-7-8-13(18-2)10-14(11)16-15(12)17/h7-10,15-17H,3-6H2,1-2H3 |
| InChIKey | CHXKWWLVMGPPSR-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 7-methoxy-3-pentyl-1,2-dihydroquinolin-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methoxy-3-pentyl-1,2-dihydroquinolin-2-ol?
The IUPAC name of 7-methoxy-3-pentyl-1,2-dihydroquinolin-2-ol (CID 90058164) is 7-methoxy-3-pentyl-1,2-dihydroquinolin-2-ol.
What is the SMILES notation for 7-methoxy-3-pentyl-1,2-dihydroquinolin-2-ol?
The canonical SMILES for 7-methoxy-3-pentyl-1,2-dihydroquinolin-2-ol is CCCCCC1=Cc2ccc(OC)cc2NC1O.
What is the InChIKey of 7-methoxy-3-pentyl-1,2-dihydroquinolin-2-ol?
The InChIKey is CHXKWWLVMGPPSR-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21NO2/c1-3-4-5-6-12-9-11-7-8-13(18-2)10-14(11)16-15(12)17/h7-10,15-17H,3-6H2,1-2H3.
What are the key properties of 7-methoxy-3-pentyl-1,2-dihydroquinolin-2-ol?
7-methoxy-3-pentyl-1,2-dihydroquinolin-2-ol has a molecular weight of 247.34 g/mol, XLogP of 3.40, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methoxy-3-pentyl-1,2-dihydroquinolin-2-ol is sourced from PubChem (CID 90058164), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).