C20H21N5O — CID 90058675
(9R)-16-methyl-3,7,14,17,23-pentazapentacyclo[13.6.2.12,5.04,9.018,22]tetracosa-1(22),2(24),4,15(23),16,18,20-heptaen-6-one (PubChem CID 90058675) has the molecular formula C20H21N5O and a molecular weight of 347.42 g/mol. Its IUPAC name is (9R)-16-methyl-3,7,14,17,23-pentazapentacyclo[13.6.2.12,5.04,9.018,22]tetracosa-1(22),2(24),4,15(23),16,18,20-heptaen-6-one.
| Compound Name | (9R)-16-methyl-3,7,14,17,23-pentazapentacyclo[13.6.2.12,5.04,9.018,22]tetracosa-1(22),2(24),4,15(23),16,18,20-heptaen-6-one |
|---|---|
| PubChem CID | 90058675 |
| Molecular Formula | C20H21N5O |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.17 |
| IUPAC Name | (9R)-16-methyl-3,7,14,17,23-pentazapentacyclo[13.6.2.12,5.04,9.018,22]tetracosa-1(22),2(24),4,15(23),16,18,20-heptaen-6-one |
| SMILES | Cc1nc2cccc3c2nc1NCCCC[C@@H]1CNC(=O)c2cc-3[nH]c21 |
| InChI | InChI=1S/C20H21N5O/c1-11-19-21-8-3-2-5-12-10-22-20(26)14-9-16(24-17(12)14)13-6-4-7-15(23-11)18(13)25-19/h4,6-7,9,12,24H,2-3,5,8,10H2,1H3,(H,21,25)(H,22,26)/t12-/m1/s1 |
| InChIKey | MLAWVMHISKOVHW-GFCCVEGCSA-N |
| XLogP | 3.36 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |