C22H21N5O — CID 90058782
(9S)-17-methyl-3,7,15,18,24-pentazahexacyclo[14.6.2.12,5.112,14.04,9.019,23]hexacosa-1(23),2(26),4,11,16(24),17,19,21-octaen-6-one (PubChem CID 90058782) has the molecular formula C22H21N5O and a molecular weight of 371.44 g/mol. Its IUPAC name is (9S)-17-methyl-3,7,15,18,24-pentazahexacyclo[14.6.2.12,5.112,14.04,9.019,23]hexacosa-1(23),2(26),4,11,16(24),17,19,21-octaen-6-one.
| Compound Name | (9S)-17-methyl-3,7,15,18,24-pentazahexacyclo[14.6.2.12,5.112,14.04,9.019,23]hexacosa-1(23),2(26),4,11,16(24),17,19,21-octaen-6-one |
|---|---|
| PubChem CID | 90058782 |
| Molecular Formula | C22H21N5O |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.17 |
| IUPAC Name | (9S)-17-methyl-3,7,15,18,24-pentazahexacyclo[14.6.2.12,5.112,14.04,9.019,23]hexacosa-1(23),2(26),4,11,16(24),17,19,21-octaen-6-one |
| SMILES | Cc1nc2cccc3c2nc1NC1CC(=CC[C@H]2CNC(=O)c4cc-3[nH]c42)C1 |
| InChI | InChI=1S/C22H21N5O/c1-11-21-25-14-7-12(8-14)5-6-13-10-23-22(28)16-9-18(26-19(13)16)15-3-2-4-17(24-11)20(15)27-21/h2-5,9,13-14,26H,6-8,10H2,1H3,(H,23,28)(H,25,27)/b12-5-/t13-,14?/m0/s1 |
| InChIKey | XUAJAOYEMZFGEM-RCNQKTOLSA-N |
| XLogP | 3.66 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|