C15H21F3O — CID 90059064
1-[(3Z,5Z)-4-methylhepta-1,3,5-trien-3-yl]oxy-4-(trifluoromethyl)cyclohexane (PubChem CID 90059064) has the molecular formula C15H21F3O and a molecular weight of 274.33 g/mol. Its IUPAC name is 1-[(3Z,5Z)-4-methylhepta-1,3,5-trien-3-yl]oxy-4-(trifluoromethyl)cyclohexane.
| Compound Name | 1-[(3Z,5Z)-4-methylhepta-1,3,5-trien-3-yl]oxy-4-(trifluoromethyl)cyclohexane |
|---|---|
| PubChem CID | 90059064 |
| Molecular Formula | C15H21F3O |
| Molecular Weight | 274.33 g/mol |
| Exact Mass | 274.15 |
| IUPAC Name | 1-[(3Z,5Z)-4-methylhepta-1,3,5-trien-3-yl]oxy-4-(trifluoromethyl)cyclohexane |
| SMILES | C=C/C(OC1CCC(C(F)(F)F)CC1)=C(C)/C=C\C |
| InChI | InChI=1S/C15H21F3O/c1-4-6-11(3)14(5-2)19-13-9-7-12(8-10-13)15(16,17)18/h4-6,12-13H,2,7-10H2,1,3H3/b6-4-,14-11- |
| InChIKey | PPMTVCGEPBKKEB-HHJZQNEQSA-N |
| XLogP | 5.16 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.33 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|