C57H55NO4S2 — CID 90059130
2-[[5-[7-[5-[(1,3-dioxoinden-2-ylidene)methyl]thiophen-2-yl]-9-heptadecan-9-ylcarbazol-2-yl]thiophen-2-yl]methylidene]indene-1,3-dione (PubChem CID 90059130) has the molecular formula C57H55NO4S2 and a molecular weight of 882.20 g/mol. Its IUPAC name is 2-[[5-[7-[5-[(1,3-dioxoinden-2-ylidene)methyl]thiophen-2-yl]-9-heptadecan-9-ylcarbazol-2-yl]thiophen-2-yl]methylidene]indene-1,3-dione.
| Compound Name | 2-[[5-[7-[5-[(1,3-dioxoinden-2-ylidene)methyl]thiophen-2-yl]-9-heptadecan-9-ylcarbazol-2-yl]thiophen-2-yl]methylidene]indene-1,3-dione |
|---|---|
| PubChem CID | 90059130 |
| Molecular Formula | C57H55NO4S2 |
| Molecular Weight | 882.20 g/mol |
| Exact Mass | 881.36 |
| IUPAC Name | 2-[[5-[7-[5-[(1,3-dioxoinden-2-ylidene)methyl]thiophen-2-yl]-9-heptadecan-9-ylcarbazol-2-yl]thiophen-2-yl]methylidene]indene-1,3-dione |
| SMILES | CCCCCCCCC(CCCCCCCC)n1c2cc(-c3ccc(C=C4C(=O)c5ccccc5C4=O)s3)ccc2c2ccc(-c3ccc(C=C4C(=O)c5ccccc5C4=O)s3)cc21 |
| InChI | InChI=1S/C57H55NO4S2/c1-3-5-7-9-11-13-19-39(20-14-12-10-8-6-4-2)58-50-33-37(52-31-27-40(63-52)35-48-54(59)44-21-15-16-22-45(44)55(48)60)25-29-42(50)43-30-26-38(34-51(43)58)53-32-28-41(64-53)36-49-56(61)46-23-17-18-24-47(46)57(49)62/h15-18,21-36,39H,3-14,19-20H2,1-2H3 |
| InChIKey | HLNSSSGVKSFQFO-UHFFFAOYSA-N |
| XLogP | 16.22 |
| TPSA | 73.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 882.20 |
| LogP ≤ 5 | 16.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_five_one_A(55)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|