C19H20Cl2O4 — CID 90059475
(5S,6E,8E,10R)-13-(3,4-dichlorophenyl)-5,10-dihydroxytrideca-6,8-dien-12-ynoic acid (PubChem CID 90059475) has the molecular formula C19H20Cl2O4 and a molecular weight of 383.27 g/mol. Its IUPAC name is (5S,6E,8E,10R)-13-(3,4-dichlorophenyl)-5,10-dihydroxytrideca-6,8-dien-12-ynoic acid.
| Compound Name | (5S,6E,8E,10R)-13-(3,4-dichlorophenyl)-5,10-dihydroxytrideca-6,8-dien-12-ynoic acid |
|---|---|
| PubChem CID | 90059475 |
| Molecular Formula | C19H20Cl2O4 |
| Molecular Weight | 383.27 g/mol |
| Exact Mass | 382.07 |
| IUPAC Name | (5S,6E,8E,10R)-13-(3,4-dichlorophenyl)-5,10-dihydroxytrideca-6,8-dien-12-ynoic acid |
| SMILES | O=C(O)CCC[C@H](O)/C=C/C=C/[C@H](O)CC#Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C19H20Cl2O4/c20-17-12-11-14(13-18(17)21)5-3-8-15(22)6-1-2-7-16(23)9-4-10-19(24)25/h1-2,6-7,11-13,15-16,22-23H,4,8-10H2,(H,24,25)/b6-1+,7-2+/t15-,16+/m0/s1 |
| InChIKey | RSSXIWNYBWHIBT-RINYAVKVSA-N |
| XLogP | 3.82 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.27 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|