About 2-(9,9'-spirobi[fluorene]-4'-yl)-4,6-bis(trifluoromethyl)pyrimidine
2-(9,9'-spirobi[fluorene]-4'-yl)-4,6-bis(trifluoromethyl)pyrimidine (PubChem CID 90059503) has the molecular formula C31H16F6N2
and a molecular weight of 530.47 g/mol. Its IUPAC name is 2-(9,9'-spirobi[fluorene]-4'-yl)-4,6-bis(trifluoromethyl)pyrimidine.
Molecular Properties
| Compound Name | 2-(9,9'-spirobi[fluorene]-4'-yl)-4,6-bis(trifluoromethyl)pyrimidine |
| PubChem CID | 90059503 |
| Molecular Formula | C31H16F6N2 |
| Molecular Weight | 530.47 g/mol |
| Exact Mass | 530.12 |
| IUPAC Name | 2-(9,9'-spirobi[fluorene]-4'-yl)-4,6-bis(trifluoromethyl)pyrimidine |
| SMILES | FC(F)(F)c1cc(C(F)(F)F)nc(-c2cccc3c2-c2ccccc2C32c3ccccc3-c3ccccc32)n1 |
| InChI | InChI=1S/C31H16F6N2/c32-30(33,34)25-16-26(31(35,36)37)39-28(38-25)20-11-7-15-24-27(20)19-10-3-6-14-23(19)29(24)21-12-4-1-8-17(21)18-9-2-5-13-22(18)29/h1-16H |
| InChIKey | JJHJIORLNAAHOO-UHFFFAOYSA-N |
| XLogP | 8.52 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 530.47 |
| LogP ≤ 5 | 8.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(9,9'-spirobi[fluorene]-4'-yl)-4,6-bis(trifluoromethyl)pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(9,9'-spirobi[fluorene]-4'-yl)-4,6-bis(trifluoromethyl)pyrimidine?
The IUPAC name of 2-(9,9'-spirobi[fluorene]-4'-yl)-4,6-bis(trifluoromethyl)pyrimidine (CID 90059503) is 2-(9,9'-spirobi[fluorene]-4'-yl)-4,6-bis(trifluoromethyl)pyrimidine.
What is the SMILES notation for 2-(9,9'-spirobi[fluorene]-4'-yl)-4,6-bis(trifluoromethyl)pyrimidine?
The canonical SMILES for 2-(9,9'-spirobi[fluorene]-4'-yl)-4,6-bis(trifluoromethyl)pyrimidine is FC(F)(F)c1cc(C(F)(F)F)nc(-c2cccc3c2-c2ccccc2C32c3ccccc3-c3ccccc32)n1.
What is the InChIKey of 2-(9,9'-spirobi[fluorene]-4'-yl)-4,6-bis(trifluoromethyl)pyrimidine?
The InChIKey is JJHJIORLNAAHOO-UHFFFAOYSA-N. The full InChI is InChI=1S/C31H16F6N2/c32-30(33,34)25-16-26(31(35,36)37)39-28(38-25)20-11-7-15-24-27(20)19-10-3-6-14-23(19)29(24)21-12-4-1-8-17(21)18-9-2-5-13-22(18)29/h1-16H.
What are the key properties of 2-(9,9'-spirobi[fluorene]-4'-yl)-4,6-bis(trifluoromethyl)pyrimidine?
2-(9,9'-spirobi[fluorene]-4'-yl)-4,6-bis(trifluoromethyl)pyrimidine has a molecular weight of 530.47 g/mol, XLogP of 8.52, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(9,9'-spirobi[fluorene]-4'-yl)-4,6-bis(trifluoromethyl)pyrimidine is sourced from PubChem (CID 90059503), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).