About 2-[4-(9,9'-spirobi[fluorene]-4'-yl)phenyl]-4,6-bis(trifluoromethyl)pyrimidine
2-[4-(9,9'-spirobi[fluorene]-4'-yl)phenyl]-4,6-bis(trifluoromethyl)pyrimidine (PubChem CID 90059529) has the molecular formula C37H20F6N2
and a molecular weight of 606.57 g/mol. Its IUPAC name is 2-[4-(9,9'-spirobi[fluorene]-4'-yl)phenyl]-4,6-bis(trifluoromethyl)pyrimidine.
Molecular Properties
| Compound Name | 2-[4-(9,9'-spirobi[fluorene]-4'-yl)phenyl]-4,6-bis(trifluoromethyl)pyrimidine |
| PubChem CID | 90059529 |
| Molecular Formula | C37H20F6N2 |
| Molecular Weight | 606.57 g/mol |
| Exact Mass | 606.15 |
| IUPAC Name | 2-[4-(9,9'-spirobi[fluorene]-4'-yl)phenyl]-4,6-bis(trifluoromethyl)pyrimidine |
| SMILES | FC(F)(F)c1cc(C(F)(F)F)nc(-c2ccc(-c3cccc4c3-c3ccccc3C43c4ccccc4-c4ccccc43)cc2)n1 |
| InChI | InChI=1S/C37H20F6N2/c38-36(39,40)31-20-32(37(41,42)43)45-34(44-31)22-18-16-21(17-19-22)23-11-7-15-30-33(23)26-10-3-6-14-29(26)35(30)27-12-4-1-8-24(27)25-9-2-5-13-28(25)35/h1-20H |
| InChIKey | RZXMHCKMQQRRHV-UHFFFAOYSA-N |
| XLogP | 10.19 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 45 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 606.57 |
| LogP ≤ 5 | 10.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[4-(9,9'-spirobi[fluorene]-4'-yl)phenyl]-4,6-bis(trifluoromethyl)pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(9,9'-spirobi[fluorene]-4'-yl)phenyl]-4,6-bis(trifluoromethyl)pyrimidine?
The IUPAC name of 2-[4-(9,9'-spirobi[fluorene]-4'-yl)phenyl]-4,6-bis(trifluoromethyl)pyrimidine (CID 90059529) is 2-[4-(9,9'-spirobi[fluorene]-4'-yl)phenyl]-4,6-bis(trifluoromethyl)pyrimidine.
What is the SMILES notation for 2-[4-(9,9'-spirobi[fluorene]-4'-yl)phenyl]-4,6-bis(trifluoromethyl)pyrimidine?
The canonical SMILES for 2-[4-(9,9'-spirobi[fluorene]-4'-yl)phenyl]-4,6-bis(trifluoromethyl)pyrimidine is FC(F)(F)c1cc(C(F)(F)F)nc(-c2ccc(-c3cccc4c3-c3ccccc3C43c4ccccc4-c4ccccc43)cc2)n1.
What is the InChIKey of 2-[4-(9,9'-spirobi[fluorene]-4'-yl)phenyl]-4,6-bis(trifluoromethyl)pyrimidine?
The InChIKey is RZXMHCKMQQRRHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C37H20F6N2/c38-36(39,40)31-20-32(37(41,42)43)45-34(44-31)22-18-16-21(17-19-22)23-11-7-15-30-33(23)26-10-3-6-14-29(26)35(30)27-12-4-1-8-24(27)25-9-2-5-13-28(25)35/h1-20H.
What are the key properties of 2-[4-(9,9'-spirobi[fluorene]-4'-yl)phenyl]-4,6-bis(trifluoromethyl)pyrimidine?
2-[4-(9,9'-spirobi[fluorene]-4'-yl)phenyl]-4,6-bis(trifluoromethyl)pyrimidine has a molecular weight of 606.57 g/mol, XLogP of 10.19, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(9,9'-spirobi[fluorene]-4'-yl)phenyl]-4,6-bis(trifluoromethyl)pyrimidine is sourced from PubChem (CID 90059529), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).