C24H45NO7 — CID 90059583
2-[(2R,3R,4R,5R)-3,4-dibutoxy-5-(butoxymethyl)-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidin-2-yl]acetic acid (PubChem CID 90059583) has the molecular formula C24H45NO7 and a molecular weight of 459.62 g/mol. Its IUPAC name is 2-[(2R,3R,4R,5R)-3,4-dibutoxy-5-(butoxymethyl)-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidin-2-yl]acetic acid.
| Compound Name | 2-[(2R,3R,4R,5R)-3,4-dibutoxy-5-(butoxymethyl)-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidin-2-yl]acetic acid |
|---|---|
| PubChem CID | 90059583 |
| Molecular Formula | C24H45NO7 |
| Molecular Weight | 459.62 g/mol |
| Exact Mass | 459.32 |
| IUPAC Name | 2-[(2R,3R,4R,5R)-3,4-dibutoxy-5-(butoxymethyl)-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidin-2-yl]acetic acid |
| SMILES | CCCCOC[C@@H]1[C@@H](OCCCC)[C@H](OCCCC)[C@@H](CC(=O)O)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C24H45NO7/c1-7-10-13-29-17-19-22(31-15-12-9-3)21(30-14-11-8-2)18(16-20(26)27)25(19)23(28)32-24(4,5)6/h18-19,21-22H,7-17H2,1-6H3,(H,26,27)/t18-,19-,21-,22-/m1/s1 |
| InChIKey | UPICNQZRWDYTSH-UGESXGAOSA-N |
| XLogP | 4.64 |
| TPSA | 94.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.62 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|