C18H27N5OS — CID 90059722
(2R,3S)-3-[[(4-amino-5H-pyrrolo[3,2-d]pyrimidin-7-yl)methylamino]methyl]-4-hex-5-ynylsulfanylbutan-2-ol (PubChem CID 90059722) has the molecular formula C18H27N5OS and a molecular weight of 361.52 g/mol. Its IUPAC name is (2R,3S)-3-[[(4-amino-5H-pyrrolo[3,2-d]pyrimidin-7-yl)methylamino]methyl]-4-hex-5-ynylsulfanylbutan-2-ol.
| Compound Name | (2R,3S)-3-[[(4-amino-5H-pyrrolo[3,2-d]pyrimidin-7-yl)methylamino]methyl]-4-hex-5-ynylsulfanylbutan-2-ol |
|---|---|
| PubChem CID | 90059722 |
| Molecular Formula | C18H27N5OS |
| Molecular Weight | 361.52 g/mol |
| Exact Mass | 361.19 |
| IUPAC Name | (2R,3S)-3-[[(4-amino-5H-pyrrolo[3,2-d]pyrimidin-7-yl)methylamino]methyl]-4-hex-5-ynylsulfanylbutan-2-ol |
| SMILES | C#CCCCCSC[C@@H](CNCc1c[nH]c2c(N)ncnc12)[C@@H](C)O |
| InChI | InChI=1S/C18H27N5OS/c1-3-4-5-6-7-25-11-15(13(2)24)9-20-8-14-10-21-17-16(14)22-12-23-18(17)19/h1,10,12-13,15,20-21,24H,4-9,11H2,2H3,(H2,19,22,23)/t13-,15-/m1/s1 |
| InChIKey | MENZYDKLFLBFLV-UKRRQHHQSA-N |
| XLogP | 2.16 |
| TPSA | 99.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.52 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|