C17H29N5OS — CID 90059755
(2R,3S)-3-[[(4-amino-5H-pyrrolo[3,2-d]pyrimidin-7-yl)methylamino]methyl]-4-pentylsulfanylbutan-2-ol (PubChem CID 90059755) has the molecular formula C17H29N5OS and a molecular weight of 351.52 g/mol. Its IUPAC name is (2R,3S)-3-[[(4-amino-5H-pyrrolo[3,2-d]pyrimidin-7-yl)methylamino]methyl]-4-pentylsulfanylbutan-2-ol.
| Compound Name | (2R,3S)-3-[[(4-amino-5H-pyrrolo[3,2-d]pyrimidin-7-yl)methylamino]methyl]-4-pentylsulfanylbutan-2-ol |
|---|---|
| PubChem CID | 90059755 |
| Molecular Formula | C17H29N5OS |
| Molecular Weight | 351.52 g/mol |
| Exact Mass | 351.21 |
| IUPAC Name | (2R,3S)-3-[[(4-amino-5H-pyrrolo[3,2-d]pyrimidin-7-yl)methylamino]methyl]-4-pentylsulfanylbutan-2-ol |
| SMILES | CCCCCSC[C@@H](CNCc1c[nH]c2c(N)ncnc12)[C@@H](C)O |
| InChI | InChI=1S/C17H29N5OS/c1-3-4-5-6-24-10-14(12(2)23)8-19-7-13-9-20-16-15(13)21-11-22-17(16)18/h9,11-12,14,19-20,23H,3-8,10H2,1-2H3,(H2,18,21,22)/t12-,14-/m1/s1 |
| InChIKey | FBYHTEAXCBYKGU-TZMCWYRMSA-N |
| XLogP | 2.55 |
| TPSA | 99.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.52 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|