C13H21NO3 — CID 90060132
(1S,2S)-2-amino-1-methoxy-3-[(4S)-4-prop-2-enoxycyclohexa-1,5-dien-1-yl]propan-1-ol (PubChem CID 90060132) has the molecular formula C13H21NO3 and a molecular weight of 239.31 g/mol. Its IUPAC name is (1S,2S)-2-amino-1-methoxy-3-[(4S)-4-prop-2-enoxycyclohexa-1,5-dien-1-yl]propan-1-ol.
| Compound Name | (1S,2S)-2-amino-1-methoxy-3-[(4S)-4-prop-2-enoxycyclohexa-1,5-dien-1-yl]propan-1-ol |
|---|---|
| PubChem CID | 90060132 |
| Molecular Formula | C13H21NO3 |
| Molecular Weight | 239.31 g/mol |
| Exact Mass | 239.15 |
| IUPAC Name | (1S,2S)-2-amino-1-methoxy-3-[(4S)-4-prop-2-enoxycyclohexa-1,5-dien-1-yl]propan-1-ol |
| SMILES | C=CCO[C@@H]1C=CC(C[C@H](N)[C@@H](O)OC)=CC1 |
| InChI | InChI=1S/C13H21NO3/c1-3-8-17-11-6-4-10(5-7-11)9-12(14)13(15)16-2/h3-6,11-13,15H,1,7-9,14H2,2H3/t11-,12+,13+/m1/s1 |
| InChIKey | FKVGTXUIQRPDPX-AGIUHOORSA-N |
| XLogP | 1.13 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.31 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|