C31H29ClFN3O3 — CID 90060344
(10R,14S)-14-[4-(6-acetyl-3-chloro-2-fluorophenyl)-6-oxo-2,3-dihydropyridin-1-yl]-10-methyl-8,16-diazatricyclo[13.3.1.02,7]nonadeca-1(19),2,4,6,15,17-hexaen-9-one (PubChem CID 90060344) has the molecular formula C31H29ClFN3O3 and a molecular weight of 546.04 g/mol. Its IUPAC name is (10R,14S)-14-[4-(6-acetyl-3-chloro-2-fluorophenyl)-6-oxo-2,3-dihydropyridin-1-yl]-10-methyl-8,16-diazatricyclo[13.3.1.02,7]nonadeca-1(19),2,4,6,15,17-hexaen-9-one.
| Compound Name | (10R,14S)-14-[4-(6-acetyl-3-chloro-2-fluorophenyl)-6-oxo-2,3-dihydropyridin-1-yl]-10-methyl-8,16-diazatricyclo[13.3.1.02,7]nonadeca-1(19),2,4,6,15,17-hexaen-9-one |
|---|---|
| PubChem CID | 90060344 |
| Molecular Formula | C31H29ClFN3O3 |
| Molecular Weight | 546.04 g/mol |
| Exact Mass | 545.19 |
| IUPAC Name | (10R,14S)-14-[4-(6-acetyl-3-chloro-2-fluorophenyl)-6-oxo-2,3-dihydropyridin-1-yl]-10-methyl-8,16-diazatricyclo[13.3.1.02,7]nonadeca-1(19),2,4,6,15,17-hexaen-9-one |
| SMILES | CC(=O)c1ccc(Cl)c(F)c1C1=CC(=O)N([C@H]2CCC[C@@H](C)C(=O)Nc3ccccc3-c3ccnc2c3)CC1 |
| InChI | InChI=1S/C31H29ClFN3O3/c1-18-6-5-9-27(26-16-20(12-14-34-26)23-7-3-4-8-25(23)35-31(18)39)36-15-13-21(17-28(36)38)29-22(19(2)37)10-11-24(32)30(29)33/h3-4,7-8,10-12,14,16-18,27H,5-6,9,13,15H2,1-2H3,(H,35,39)/t18-,27+/m1/s1 |
| InChIKey | KZFXDGGAQOKLCK-CLYVBNDRSA-N |
| XLogP | 6.86 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.04 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |