C32H29ClF2N4O2 — CID 90060409
(13R,17S)-17-[4-(3-chloro-2,6-difluorophenyl)-6-oxo-2,3-dihydropyridin-1-yl]-6,13-dimethyl-7,11,19-triazatetracyclo[16.3.1.02,10.04,8]docosa-1(22),2(10),3,5,8,18,20-heptaen-12-one (PubChem CID 90060409) has the molecular formula C32H29ClF2N4O2 and a molecular weight of 575.06 g/mol. Its IUPAC name is (13R,17S)-17-[4-(3-chloro-2,6-difluorophenyl)-6-oxo-2,3-dihydropyridin-1-yl]-6,13-dimethyl-7,11,19-triazatetracyclo[16.3.1.02,10.04,8]docosa-1(22),2(10),3,5,8,18,20-heptaen-12-one.
| Compound Name | (13R,17S)-17-[4-(3-chloro-2,6-difluorophenyl)-6-oxo-2,3-dihydropyridin-1-yl]-6,13-dimethyl-7,11,19-triazatetracyclo[16.3.1.02,10.04,8]docosa-1(22),2(10),3,5,8,18,20-heptaen-12-one |
|---|---|
| PubChem CID | 90060409 |
| Molecular Formula | C32H29ClF2N4O2 |
| Molecular Weight | 575.06 g/mol |
| Exact Mass | 574.19 |
| IUPAC Name | (13R,17S)-17-[4-(3-chloro-2,6-difluorophenyl)-6-oxo-2,3-dihydropyridin-1-yl]-6,13-dimethyl-7,11,19-triazatetracyclo[16.3.1.02,10.04,8]docosa-1(22),2(10),3,5,8,18,20-heptaen-12-one |
| SMILES | Cc1cc2cc3c(cc2[nH]1)NC(=O)[C@H](C)CCC[C@H](N1CCC(c2c(F)ccc(Cl)c2F)=CC1=O)c1cc-3ccn1 |
| InChI | InChI=1S/C32H29ClF2N4O2/c1-17-4-3-5-28(39-11-9-20(15-29(39)40)30-24(34)7-6-23(33)31(30)35)27-14-19(8-10-36-27)22-13-21-12-18(2)37-25(21)16-26(22)38-32(17)41/h6-8,10,12-17,28,37H,3-5,9,11H2,1-2H3,(H,38,41)/t17-,28+/m1/s1 |
| InChIKey | BYJKGDLDKOUHHL-UULLZXFKSA-N |
| XLogP | 7.59 |
| TPSA | 78.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.06 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|