C28H27ClF2N4O2 — CID 90060434
(10R,14S)-14-[4-(3-chloro-2,6-difluorophenyl)-6-oxo-2,3-dihydropyridin-1-yl]-10,17-dimethyl-8,16,18-triazatricyclo[13.2.1.02,7]octadeca-1(17),2,4,6,15(18)-pentaen-9-one (PubChem CID 90060434) has the molecular formula C28H27ClF2N4O2 and a molecular weight of 525.00 g/mol. Its IUPAC name is (10R,14S)-14-[4-(3-chloro-2,6-difluorophenyl)-6-oxo-2,3-dihydropyridin-1-yl]-10,17-dimethyl-8,16,18-triazatricyclo[13.2.1.02,7]octadeca-1(17),2,4,6,15(18)-pentaen-9-one.
| Compound Name | (10R,14S)-14-[4-(3-chloro-2,6-difluorophenyl)-6-oxo-2,3-dihydropyridin-1-yl]-10,17-dimethyl-8,16,18-triazatricyclo[13.2.1.02,7]octadeca-1(17),2,4,6,15(18)-pentaen-9-one |
|---|---|
| PubChem CID | 90060434 |
| Molecular Formula | C28H27ClF2N4O2 |
| Molecular Weight | 525.00 g/mol |
| Exact Mass | 524.18 |
| IUPAC Name | (10R,14S)-14-[4-(3-chloro-2,6-difluorophenyl)-6-oxo-2,3-dihydropyridin-1-yl]-10,17-dimethyl-8,16,18-triazatricyclo[13.2.1.02,7]octadeca-1(17),2,4,6,15(18)-pentaen-9-one |
| SMILES | Cc1[nH]c2nc1-c1ccccc1NC(=O)[C@H](C)CCC[C@@H]2N1CCC(c2c(F)ccc(Cl)c2F)=CC1=O |
| InChI | InChI=1S/C28H27ClF2N4O2/c1-15-6-5-9-22(27-32-16(2)26(34-27)18-7-3-4-8-21(18)33-28(15)37)35-13-12-17(14-23(35)36)24-20(30)11-10-19(29)25(24)31/h3-4,7-8,10-11,14-15,22H,5-6,9,12-13H2,1-2H3,(H,32,34)(H,33,37)/t15-,22+/m1/s1 |
| InChIKey | BCDSJPBTNNFQFA-QRQCRPRQSA-N |
| XLogP | 6.43 |
| TPSA | 78.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.00 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|