C29H26BrClFN3O2 — CID 90060445
(10R,14S)-14-[4-(6-bromo-3-chloro-2-fluorophenyl)-6-oxo-2,3-dihydropyridin-1-yl]-10-methyl-8,16-diazatricyclo[13.3.1.02,7]nonadeca-1(19),2,4,6,15,17-hexaen-9-one (PubChem CID 90060445) has the molecular formula C29H26BrClFN3O2 and a molecular weight of 582.90 g/mol. Its IUPAC name is (10R,14S)-14-[4-(6-bromo-3-chloro-2-fluorophenyl)-6-oxo-2,3-dihydropyridin-1-yl]-10-methyl-8,16-diazatricyclo[13.3.1.02,7]nonadeca-1(19),2,4,6,15,17-hexaen-9-one.
| Compound Name | (10R,14S)-14-[4-(6-bromo-3-chloro-2-fluorophenyl)-6-oxo-2,3-dihydropyridin-1-yl]-10-methyl-8,16-diazatricyclo[13.3.1.02,7]nonadeca-1(19),2,4,6,15,17-hexaen-9-one |
|---|---|
| PubChem CID | 90060445 |
| Molecular Formula | C29H26BrClFN3O2 |
| Molecular Weight | 582.90 g/mol |
| Exact Mass | 581.09 |
| IUPAC Name | (10R,14S)-14-[4-(6-bromo-3-chloro-2-fluorophenyl)-6-oxo-2,3-dihydropyridin-1-yl]-10-methyl-8,16-diazatricyclo[13.3.1.02,7]nonadeca-1(19),2,4,6,15,17-hexaen-9-one |
| SMILES | C[C@@H]1CCC[C@H](N2CCC(c3c(Br)ccc(Cl)c3F)=CC2=O)c2cc(ccn2)-c2ccccc2NC1=O |
| InChI | InChI=1S/C29H26BrClFN3O2/c1-17-5-4-8-25(24-15-18(11-13-33-24)20-6-2-3-7-23(20)34-29(17)37)35-14-12-19(16-26(35)36)27-21(30)9-10-22(31)28(27)32/h2-3,6-7,9-11,13,15-17,25H,4-5,8,12,14H2,1H3,(H,34,37)/t17-,25+/m1/s1 |
| InChIKey | MUMWTBPFGOZRHX-NSYGIPOTSA-N |
| XLogP | 7.42 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.90 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|