C50H33N9 — CID 90060850
4-(3,6-diphenylpyrrolo[2,3-c]carbazol-9-yl)-N,N-bis[4-(1,3,5-triazin-2-yl)phenyl]aniline (PubChem CID 90060850) has the molecular formula C50H33N9 and a molecular weight of 759.88 g/mol. Its IUPAC name is 4-(3,6-diphenylpyrrolo[2,3-c]carbazol-9-yl)-N,N-bis[4-(1,3,5-triazin-2-yl)phenyl]aniline.
| Compound Name | 4-(3,6-diphenylpyrrolo[2,3-c]carbazol-9-yl)-N,N-bis[4-(1,3,5-triazin-2-yl)phenyl]aniline |
|---|---|
| PubChem CID | 90060850 |
| Molecular Formula | C50H33N9 |
| Molecular Weight | 759.88 g/mol |
| Exact Mass | 759.29 |
| IUPAC Name | 4-(3,6-diphenylpyrrolo[2,3-c]carbazol-9-yl)-N,N-bis[4-(1,3,5-triazin-2-yl)phenyl]aniline |
| SMILES | c1ccc(-n2ccc3c4c5cc(-c6ccc(N(c7ccc(-c8ncncn8)cc7)c7ccc(-c8ncncn8)cc7)cc6)ccc5n(-c5ccccc5)c4ccc32)cc1 |
| InChI | InChI=1S/C50H33N9/c1-3-7-38(8-4-1)57-28-27-43-45(57)25-26-47-48(43)44-29-37(17-24-46(44)59(47)39-9-5-2-6-10-39)34-11-18-40(19-12-34)58(41-20-13-35(14-21-41)49-53-30-51-31-54-49)42-22-15-36(16-23-42)50-55-32-52-33-56-50/h1-33H |
| InChIKey | UYLUGZMYVUJJRA-UHFFFAOYSA-N |
| XLogP | 11.57 |
| TPSA | 90.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 759.88 |
| LogP ≤ 5 | 11.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |