C28H32FN3O5SSi — CID 90061793
N-[2-[2-(7-fluoro-1-benzothiophen-3-yl)-3-(2-trimethylsilylethoxymethyl)imidazol-4-yl]-2-oxoethyl]-3,4-dimethoxybenzamide (PubChem CID 90061793) has the molecular formula C28H32FN3O5SSi and a molecular weight of 569.73 g/mol. Its IUPAC name is N-[2-[2-(7-fluoro-1-benzothiophen-3-yl)-3-(2-trimethylsilylethoxymethyl)imidazol-4-yl]-2-oxoethyl]-3,4-dimethoxybenzamide.
| Compound Name | N-[2-[2-(7-fluoro-1-benzothiophen-3-yl)-3-(2-trimethylsilylethoxymethyl)imidazol-4-yl]-2-oxoethyl]-3,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 90061793 |
| Molecular Formula | C28H32FN3O5SSi |
| Molecular Weight | 569.73 g/mol |
| Exact Mass | 569.18 |
| IUPAC Name | N-[2-[2-(7-fluoro-1-benzothiophen-3-yl)-3-(2-trimethylsilylethoxymethyl)imidazol-4-yl]-2-oxoethyl]-3,4-dimethoxybenzamide |
| SMILES | COc1ccc(C(=O)NCC(=O)c2cnc(-c3csc4c(F)cccc34)n2COCC[Si](C)(C)C)cc1OC |
| InChI | InChI=1S/C28H32FN3O5SSi/c1-35-24-10-9-18(13-25(24)36-2)28(34)31-15-23(33)22-14-30-27(32(22)17-37-11-12-39(3,4)5)20-16-38-26-19(20)7-6-8-21(26)29/h6-10,13-14,16H,11-12,15,17H2,1-5H3,(H,31,34) |
| InChIKey | PINAJRGWCZEKLV-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 91.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.73 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|