C34H29FN2O7S — CID 90062164
N-[2-(13-fluoro-8-oxa-11-thia-3-azatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2(7),3,5,12(17),13,15-heptaen-4-yl)-2-oxoethyl]-3-methoxy-4-[2-[(4-methoxyphenyl)methoxy]ethoxy]benzamide (PubChem CID 90062164) has the molecular formula C34H29FN2O7S and a molecular weight of 628.68 g/mol. Its IUPAC name is N-[2-(13-fluoro-8-oxa-11-thia-3-azatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2(7),3,5,12(17),13,15-heptaen-4-yl)-2-oxoethyl]-3-methoxy-4-[2-[(4-methoxyphenyl)methoxy]ethoxy]benzamide.
| Compound Name | N-[2-(13-fluoro-8-oxa-11-thia-3-azatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2(7),3,5,12(17),13,15-heptaen-4-yl)-2-oxoethyl]-3-methoxy-4-[2-[(4-methoxyphenyl)methoxy]ethoxy]benzamide |
|---|---|
| PubChem CID | 90062164 |
| Molecular Formula | C34H29FN2O7S |
| Molecular Weight | 628.68 g/mol |
| Exact Mass | 628.17 |
| IUPAC Name | N-[2-(13-fluoro-8-oxa-11-thia-3-azatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2(7),3,5,12(17),13,15-heptaen-4-yl)-2-oxoethyl]-3-methoxy-4-[2-[(4-methoxyphenyl)methoxy]ethoxy]benzamide |
| SMILES | COc1ccc(COCCOc2ccc(C(=O)NCC(=O)c3ccc4c(n3)-c3c(sc5c(F)cccc35)CO4)cc2OC)cc1 |
| InChI | InChI=1S/C34H29FN2O7S/c1-40-22-9-6-20(7-10-22)18-42-14-15-43-27-12-8-21(16-29(27)41-2)34(39)36-17-26(38)25-11-13-28-32(37-25)31-23-4-3-5-24(35)33(23)45-30(31)19-44-28/h3-13,16H,14-15,17-19H2,1-2H3,(H,36,39) |
| InChIKey | YQZYKUUENFXTOU-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 105.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.68 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|