C41H29BN2 — CID 90062447
CID 90062447 (PubChem CID 90062447) has the molecular formula C41H29BN2 and a molecular weight of 560.51 g/mol.
| Compound Name | CID 90062447 |
|---|---|
| PubChem CID | 90062447 |
| Molecular Formula | C41H29BN2 |
| Molecular Weight | 560.51 g/mol |
| Exact Mass | 560.24 |
| IUPAC Name | — |
| SMILES | [B]c1ccc2c(c1)c1ccc3c(ccn3-c3ccc(-c4ccccc4)cc3)c1n2-c1ccc2c(c1)C(C)(C)c1ccccc1-2 |
| InChI | InChI=1S/C41H29BN2/c1-41(2)36-11-7-6-10-31(36)32-18-17-30(25-37(32)41)44-39-20-14-28(42)24-35(39)33-19-21-38-34(40(33)44)22-23-43(38)29-15-12-27(13-16-29)26-8-4-3-5-9-26/h3-25H,1-2H3 |
| InChIKey | LUVSWPXLGPUVLG-UHFFFAOYSA-N |
| XLogP | 9.49 |
| TPSA | 9.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.51 |
| LogP ≤ 5 | 9.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|