C40H39BN2O — CID 90062606
[4-(3,10-diphenylpyrrolo[3,2-a]carbazol-7-yl)phenyl]-methyl-(2,3,3-trimethylbutan-2-yloxy)borane (PubChem CID 90062606) has the molecular formula C40H39BN2O and a molecular weight of 574.58 g/mol. Its IUPAC name is [4-(3,10-diphenylpyrrolo[3,2-a]carbazol-7-yl)phenyl]-methyl-(2,3,3-trimethylbutan-2-yloxy)borane.
| Compound Name | [4-(3,10-diphenylpyrrolo[3,2-a]carbazol-7-yl)phenyl]-methyl-(2,3,3-trimethylbutan-2-yloxy)borane |
|---|---|
| PubChem CID | 90062606 |
| Molecular Formula | C40H39BN2O |
| Molecular Weight | 574.58 g/mol |
| Exact Mass | 574.32 |
| IUPAC Name | [4-(3,10-diphenylpyrrolo[3,2-a]carbazol-7-yl)phenyl]-methyl-(2,3,3-trimethylbutan-2-yloxy)borane |
| SMILES | CB(OC(C)(C)C(C)(C)C)c1ccc(-c2ccc3c(c2)c2ccc4c(ccn4-c4ccccc4)c2n3-c2ccccc2)cc1 |
| InChI | InChI=1S/C40H39BN2O/c1-39(2,3)40(4,5)44-41(6)30-20-17-28(18-21-30)29-19-23-37-35(27-29)33-22-24-36-34(25-26-42(36)31-13-9-7-10-14-31)38(33)43(37)32-15-11-8-12-16-32/h7-27H,1-6H3 |
| InChIKey | VIJVXQLVXYJSCK-UHFFFAOYSA-N |
| XLogP | 10.06 |
| TPSA | 19.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.58 |
| LogP ≤ 5 | 10.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|