C8H8F3IN2S — CID 90062904
2-iodo-5-(2,2,2-trifluoroethyl)-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine (PubChem CID 90062904) has the molecular formula C8H8F3IN2S and a molecular weight of 348.13 g/mol. Its IUPAC name is 2-iodo-5-(2,2,2-trifluoroethyl)-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine.
| Compound Name | 2-iodo-5-(2,2,2-trifluoroethyl)-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine |
|---|---|
| PubChem CID | 90062904 |
| Molecular Formula | C8H8F3IN2S |
| Molecular Weight | 348.13 g/mol |
| Exact Mass | 347.94 |
| IUPAC Name | 2-iodo-5-(2,2,2-trifluoroethyl)-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine |
| SMILES | FC(F)(F)CN1CCc2nc(I)sc2C1 |
| InChI | InChI=1S/C8H8F3IN2S/c9-8(10,11)4-14-2-1-5-6(3-14)15-7(12)13-5/h1-4H2 |
| InChIKey | SBJQZRNCQPXMNG-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.13 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|