About 5-(cyclopropylmethyl)-2-iodo-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine
5-(cyclopropylmethyl)-2-iodo-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine (PubChem CID 90062906) has the molecular formula C10H13IN2S
and a molecular weight of 320.20 g/mol. Its IUPAC name is 5-(cyclopropylmethyl)-2-iodo-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine.
Molecular Properties
| Compound Name | 5-(cyclopropylmethyl)-2-iodo-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine |
| PubChem CID | 90062906 |
| Molecular Formula | C10H13IN2S |
| Molecular Weight | 320.20 g/mol |
| Exact Mass | 319.98 |
| IUPAC Name | 5-(cyclopropylmethyl)-2-iodo-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine |
| SMILES | Ic1nc2c(s1)CN(CC1CC1)CC2 |
| InChI | InChI=1S/C10H13IN2S/c11-10-12-8-3-4-13(5-7-1-2-7)6-9(8)14-10/h7H,1-6H2 |
| InChIKey | RVNMSKJIKGDIIW-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.20 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 5-(cyclopropylmethyl)-2-iodo-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(cyclopropylmethyl)-2-iodo-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine?
The IUPAC name of 5-(cyclopropylmethyl)-2-iodo-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine (CID 90062906) is 5-(cyclopropylmethyl)-2-iodo-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine.
What is the SMILES notation for 5-(cyclopropylmethyl)-2-iodo-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine?
The canonical SMILES for 5-(cyclopropylmethyl)-2-iodo-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine is Ic1nc2c(s1)CN(CC1CC1)CC2.
What is the InChIKey of 5-(cyclopropylmethyl)-2-iodo-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine?
The InChIKey is RVNMSKJIKGDIIW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13IN2S/c11-10-12-8-3-4-13(5-7-1-2-7)6-9(8)14-10/h7H,1-6H2.
What are the key properties of 5-(cyclopropylmethyl)-2-iodo-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine?
5-(cyclopropylmethyl)-2-iodo-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine has a molecular weight of 320.20 g/mol, XLogP of 2.52, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(cyclopropylmethyl)-2-iodo-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine is sourced from PubChem (CID 90062906), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).