About cis-(1R,5S)-5-methoxy-3,3-dimethylcyclohexan-1-amine
cis-(1R,5S)-5-methoxy-3,3-dimethylcyclohexan-1-amine (PubChem CID 90063127) has the molecular formula C9H19NO
and a molecular weight of 157.26 g/mol. Its IUPAC name is cis-(1R,5S)-5-methoxy-3,3-dimethylcyclohexan-1-amine.
Molecular Properties
| Compound Name | cis-(1R,5S)-5-methoxy-3,3-dimethylcyclohexan-1-amine |
| PubChem CID | 90063127 |
| Molecular Formula | C9H19NO |
| Molecular Weight | 157.26 g/mol |
| Exact Mass | 157.15 |
| IUPAC Name | cis-(1R,5S)-5-methoxy-3,3-dimethylcyclohexan-1-amine |
| SMILES | CO[C@@H]1C[C@H](N)CC(C)(C)C1 |
| InChI | InChI=1S/C9H19NO/c1-9(2)5-7(10)4-8(6-9)11-3/h7-8H,4-6,10H2,1-3H3/t7-,8+/m0/s1 |
| InChIKey | TUJCNJGOSXWYJR-JGVFFNPUSA-N |
| XLogP | 1.54 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.26 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze cis-(1R,5S)-5-methoxy-3,3-dimethylcyclohexan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cis-(1R,5S)-5-methoxy-3,3-dimethylcyclohexan-1-amine?
The IUPAC name of cis-(1R,5S)-5-methoxy-3,3-dimethylcyclohexan-1-amine (CID 90063127) is cis-(1R,5S)-5-methoxy-3,3-dimethylcyclohexan-1-amine.
What is the SMILES notation for cis-(1R,5S)-5-methoxy-3,3-dimethylcyclohexan-1-amine?
The canonical SMILES for cis-(1R,5S)-5-methoxy-3,3-dimethylcyclohexan-1-amine is CO[C@@H]1C[C@H](N)CC(C)(C)C1.
What is the InChIKey of cis-(1R,5S)-5-methoxy-3,3-dimethylcyclohexan-1-amine?
The InChIKey is TUJCNJGOSXWYJR-JGVFFNPUSA-N. The full InChI is InChI=1S/C9H19NO/c1-9(2)5-7(10)4-8(6-9)11-3/h7-8H,4-6,10H2,1-3H3/t7-,8+/m0/s1.
What are the key properties of cis-(1R,5S)-5-methoxy-3,3-dimethylcyclohexan-1-amine?
cis-(1R,5S)-5-methoxy-3,3-dimethylcyclohexan-1-amine has a molecular weight of 157.26 g/mol, XLogP of 1.54, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cis-(1R,5S)-5-methoxy-3,3-dimethylcyclohexan-1-amine is sourced from PubChem (CID 90063127), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).