About 3-[amino(propyl)amino]-2H-1,2,4-oxadiazole-5-thione
3-[amino(propyl)amino]-2H-1,2,4-oxadiazole-5-thione (PubChem CID 90063583) has the molecular formula C5H10N4OS
and a molecular weight of 174.23 g/mol. Its IUPAC name is 3-[amino(propyl)amino]-2H-1,2,4-oxadiazole-5-thione.
Molecular Properties
| Compound Name | 3-[amino(propyl)amino]-2H-1,2,4-oxadiazole-5-thione |
| PubChem CID | 90063583 |
| Molecular Formula | C5H10N4OS |
| Molecular Weight | 174.23 g/mol |
| Exact Mass | 174.06 |
| IUPAC Name | 3-[amino(propyl)amino]-2H-1,2,4-oxadiazole-5-thione |
| SMILES | CCCN(N)c1nc(=S)o[nH]1 |
| InChI | InChI=1S/C5H10N4OS/c1-2-3-9(6)4-7-5(11)10-8-4/h2-3,6H2,1H3,(H,7,8,11) |
| InChIKey | ZLQZEXQFMIJGEB-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 71.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.23 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3-[amino(propyl)amino]-2H-1,2,4-oxadiazole-5-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[amino(propyl)amino]-2H-1,2,4-oxadiazole-5-thione?
The IUPAC name of 3-[amino(propyl)amino]-2H-1,2,4-oxadiazole-5-thione (CID 90063583) is 3-[amino(propyl)amino]-2H-1,2,4-oxadiazole-5-thione.
What is the SMILES notation for 3-[amino(propyl)amino]-2H-1,2,4-oxadiazole-5-thione?
The canonical SMILES for 3-[amino(propyl)amino]-2H-1,2,4-oxadiazole-5-thione is CCCN(N)c1nc(=S)o[nH]1.
What is the InChIKey of 3-[amino(propyl)amino]-2H-1,2,4-oxadiazole-5-thione?
The InChIKey is ZLQZEXQFMIJGEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10N4OS/c1-2-3-9(6)4-7-5(11)10-8-4/h2-3,6H2,1H3,(H,7,8,11).
What are the key properties of 3-[amino(propyl)amino]-2H-1,2,4-oxadiazole-5-thione?
3-[amino(propyl)amino]-2H-1,2,4-oxadiazole-5-thione has a molecular weight of 174.23 g/mol, XLogP of 0.82, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[amino(propyl)amino]-2H-1,2,4-oxadiazole-5-thione is sourced from PubChem (CID 90063583), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).