C5H11N5S — CID 90063608
5-[amino(propyl)amino]-1,2-dihydro-1,2,4-triazole-3-thione (PubChem CID 90063608) has the molecular formula C5H11N5S and a molecular weight of 173.25 g/mol. Its IUPAC name is 5-[amino(propyl)amino]-1,2-dihydro-1,2,4-triazole-3-thione.
| Compound Name | 5-[amino(propyl)amino]-1,2-dihydro-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 90063608 |
| Molecular Formula | C5H11N5S |
| Molecular Weight | 173.25 g/mol |
| Exact Mass | 173.07 |
| IUPAC Name | 5-[amino(propyl)amino]-1,2-dihydro-1,2,4-triazole-3-thione |
| SMILES | CCCN(N)c1nc(=S)[nH][nH]1 |
| InChI | InChI=1S/C5H11N5S/c1-2-3-10(6)4-7-5(11)9-8-4/h2-3,6H2,1H3,(H2,7,8,9,11) |
| InChIKey | PXJRGYSUQMTMBZ-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 73.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.25 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|