C6H14N6S — CID 90063894
5-[amino-[2-(dimethylamino)ethyl]amino]-1,2-dihydro-1,2,4-triazole-3-thione (PubChem CID 90063894) has the molecular formula C6H14N6S and a molecular weight of 202.29 g/mol. Its IUPAC name is 5-[amino-[2-(dimethylamino)ethyl]amino]-1,2-dihydro-1,2,4-triazole-3-thione.
| Compound Name | 5-[amino-[2-(dimethylamino)ethyl]amino]-1,2-dihydro-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 90063894 |
| Molecular Formula | C6H14N6S |
| Molecular Weight | 202.29 g/mol |
| Exact Mass | 202.10 |
| IUPAC Name | 5-[amino-[2-(dimethylamino)ethyl]amino]-1,2-dihydro-1,2,4-triazole-3-thione |
| SMILES | CN(C)CCN(N)c1nc(=S)[nH][nH]1 |
| InChI | InChI=1S/C6H14N6S/c1-11(2)3-4-12(7)5-8-6(13)10-9-5/h3-4,7H2,1-2H3,(H2,8,9,10,13) |
| InChIKey | PANVLJXFKSMVPP-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 76.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.29 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|