About 3-[amino(ethyl)amino]-1H-1,2,4-triazol-5-amine
3-[amino(ethyl)amino]-1H-1,2,4-triazol-5-amine (PubChem CID 90063907) has the molecular formula C4H10N6
and a molecular weight of 142.17 g/mol. Its IUPAC name is 3-[amino(ethyl)amino]-1H-1,2,4-triazol-5-amine.
Molecular Properties
| Compound Name | 3-[amino(ethyl)amino]-1H-1,2,4-triazol-5-amine |
| PubChem CID | 90063907 |
| Molecular Formula | C4H10N6 |
| Molecular Weight | 142.17 g/mol |
| Exact Mass | 142.10 |
| IUPAC Name | 3-[amino(ethyl)amino]-1H-1,2,4-triazol-5-amine |
| SMILES | CCN(N)c1n[nH]c(N)n1 |
| InChI | InChI=1S/C4H10N6/c1-2-10(6)4-7-3(5)8-9-4/h2,6H2,1H3,(H3,5,7,8,9) |
| InChIKey | HQFAMBUYZUVNPS-UHFFFAOYSA-N |
| XLogP | -0.91 |
| TPSA | 96.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.17 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-[amino(ethyl)amino]-1H-1,2,4-triazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[amino(ethyl)amino]-1H-1,2,4-triazol-5-amine?
The IUPAC name of 3-[amino(ethyl)amino]-1H-1,2,4-triazol-5-amine (CID 90063907) is 3-[amino(ethyl)amino]-1H-1,2,4-triazol-5-amine.
What is the SMILES notation for 3-[amino(ethyl)amino]-1H-1,2,4-triazol-5-amine?
The canonical SMILES for 3-[amino(ethyl)amino]-1H-1,2,4-triazol-5-amine is CCN(N)c1n[nH]c(N)n1.
What is the InChIKey of 3-[amino(ethyl)amino]-1H-1,2,4-triazol-5-amine?
The InChIKey is HQFAMBUYZUVNPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10N6/c1-2-10(6)4-7-3(5)8-9-4/h2,6H2,1H3,(H3,5,7,8,9).
What are the key properties of 3-[amino(ethyl)amino]-1H-1,2,4-triazol-5-amine?
3-[amino(ethyl)amino]-1H-1,2,4-triazol-5-amine has a molecular weight of 142.17 g/mol, XLogP of -0.91, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[amino(ethyl)amino]-1H-1,2,4-triazol-5-amine is sourced from PubChem (CID 90063907), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).