C4H9N5S — CID 90063962
5-[amino(ethyl)amino]-1,2-dihydro-1,2,4-triazole-3-thione (PubChem CID 90063962) has the molecular formula C4H9N5S and a molecular weight of 159.22 g/mol. Its IUPAC name is 5-[amino(ethyl)amino]-1,2-dihydro-1,2,4-triazole-3-thione.
| Compound Name | 5-[amino(ethyl)amino]-1,2-dihydro-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 90063962 |
| Molecular Formula | C4H9N5S |
| Molecular Weight | 159.22 g/mol |
| Exact Mass | 159.06 |
| IUPAC Name | 5-[amino(ethyl)amino]-1,2-dihydro-1,2,4-triazole-3-thione |
| SMILES | CCN(N)c1nc(=S)[nH][nH]1 |
| InChI | InChI=1S/C4H9N5S/c1-2-9(5)3-6-4(10)8-7-3/h2,5H2,1H3,(H2,6,7,8,10) |
| InChIKey | BQLYULLJZXQXMO-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 73.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.22 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|