C13H10F3N3O3S — CID 90064416
amino (1R)-6-amino-7,8,9-trifluoro-1-methyl-5-oxo-1,2-dihydro-[1,3]thiazolo[3,2-a]quinoline-4-carboxylate (PubChem CID 90064416) has the molecular formula C13H10F3N3O3S and a molecular weight of 345.30 g/mol. Its IUPAC name is amino (1R)-6-amino-7,8,9-trifluoro-1-methyl-5-oxo-1,2-dihydro-[1,3]thiazolo[3,2-a]quinoline-4-carboxylate.
| Compound Name | amino (1R)-6-amino-7,8,9-trifluoro-1-methyl-5-oxo-1,2-dihydro-[1,3]thiazolo[3,2-a]quinoline-4-carboxylate |
|---|---|
| PubChem CID | 90064416 |
| Molecular Formula | C13H10F3N3O3S |
| Molecular Weight | 345.30 g/mol |
| Exact Mass | 345.04 |
| IUPAC Name | amino (1R)-6-amino-7,8,9-trifluoro-1-methyl-5-oxo-1,2-dihydro-[1,3]thiazolo[3,2-a]quinoline-4-carboxylate |
| SMILES | C[C@@H]1CSc2c(C(=O)ON)c(=O)c3c(N)c(F)c(F)c(F)c3n21 |
| InChI | InChI=1S/C13H10F3N3O3S/c1-3-2-23-12-5(13(21)22-18)11(20)4-9(17)7(15)6(14)8(16)10(4)19(3)12/h3H,2,17-18H2,1H3/t3-/m1/s1 |
| InChIKey | STPZZQFUFGWGEU-GSVOUGTGSA-N |
| XLogP | 1.70 |
| TPSA | 100.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.30 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|