C17H17F6NO — CID 90064480
6-methyl-3-prop-2-enyl-1-(2,2,2-trifluoroethyl)-5-(2,3,5-trifluorophenyl)piperidin-2-one (PubChem CID 90064480) has the molecular formula C17H17F6NO and a molecular weight of 365.32 g/mol. Its IUPAC name is 6-methyl-3-prop-2-enyl-1-(2,2,2-trifluoroethyl)-5-(2,3,5-trifluorophenyl)piperidin-2-one.
| Compound Name | 6-methyl-3-prop-2-enyl-1-(2,2,2-trifluoroethyl)-5-(2,3,5-trifluorophenyl)piperidin-2-one |
|---|---|
| PubChem CID | 90064480 |
| Molecular Formula | C17H17F6NO |
| Molecular Weight | 365.32 g/mol |
| Exact Mass | 365.12 |
| IUPAC Name | 6-methyl-3-prop-2-enyl-1-(2,2,2-trifluoroethyl)-5-(2,3,5-trifluorophenyl)piperidin-2-one |
| SMILES | C=CCC1CC(c2cc(F)cc(F)c2F)C(C)N(CC(F)(F)F)C1=O |
| InChI | InChI=1S/C17H17F6NO/c1-3-4-10-5-12(13-6-11(18)7-14(19)15(13)20)9(2)24(16(10)25)8-17(21,22)23/h3,6-7,9-10,12H,1,4-5,8H2,2H3 |
| InChIKey | GVSGJIVGEGJGFT-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.32 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|